C23H28N4O3 — CID 16982026
N-[3-[1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]benzimidazol-2-yl]propyl]furan-2-carboxamide (PubChem CID 16982026) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[3-[1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]benzimidazol-2-yl]propyl]furan-2-carboxamide.
| Compound Name | N-[3-[1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]benzimidazol-2-yl]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 16982026 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[3-[1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]benzimidazol-2-yl]propyl]furan-2-carboxamide |
| SMILES | CC1CCCCN1C(=O)Cn1c(CCCNC(=O)c2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C23H28N4O3/c1-17-8-4-5-14-26(17)22(28)16-27-19-10-3-2-9-18(19)25-21(27)12-6-13-24-23(29)20-11-7-15-30-20/h2-3,7,9-11,15,17H,4-6,8,12-14,16H2,1H3,(H,24,29) |
| InChIKey | PDEYGWHZOIYJFM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|