C29H38N4O2 — CID 16992654
N-[5-[1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylpropanamide (PubChem CID 16992654) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[5-[1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylpropanamide.
| Compound Name | N-[5-[1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 16992654 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | N-[5-[1-[2-(2-methylpiperidin-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylpropanamide |
| SMILES | CC1CCCCN1C(=O)Cn1c(CCCCCNC(=O)CCc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C29H38N4O2/c1-23-12-9-11-21-32(23)29(35)22-33-26-16-8-7-15-25(26)31-27(33)17-6-3-10-20-30-28(34)19-18-24-13-4-2-5-14-24/h2,4-5,7-8,13-16,23H,3,6,9-12,17-22H2,1H3,(H,30,34) |
| InChIKey | DCTNHZRDVZHNRD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|