C18H18N2 — CID 16987511
2-(2,4-dimethylphenyl)-1-prop-2-enylbenzimidazole (PubChem CID 16987511) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-1-prop-2-enylbenzimidazole.
| Compound Name | 2-(2,4-dimethylphenyl)-1-prop-2-enylbenzimidazole |
|---|---|
| PubChem CID | 16987511 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-1-prop-2-enylbenzimidazole |
| SMILES | C=CCn1c(-c2ccc(C)cc2C)nc2ccccc21 |
| InChI | InChI=1S/C18H18N2/c1-4-11-20-17-8-6-5-7-16(17)19-18(20)15-10-9-13(2)12-14(15)3/h4-10,12H,1,11H2,2-3H3 |
| InChIKey | WCMRQZPMTSHRDW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|