C24H23N3O2 — CID 16998881
N-methyl-2-[2-(1-phenoxyethyl)benzimidazol-1-yl]-N-phenylacetamide (PubChem CID 16998881) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-methyl-2-[2-(1-phenoxyethyl)benzimidazol-1-yl]-N-phenylacetamide.
| Compound Name | N-methyl-2-[2-(1-phenoxyethyl)benzimidazol-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 16998881 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-methyl-2-[2-(1-phenoxyethyl)benzimidazol-1-yl]-N-phenylacetamide |
| SMILES | CC(Oc1ccccc1)c1nc2ccccc2n1CC(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O2/c1-18(29-20-13-7-4-8-14-20)24-25-21-15-9-10-16-22(21)27(24)17-23(28)26(2)19-11-5-3-6-12-19/h3-16,18H,17H2,1-2H3 |
| InChIKey | JBPYGDRUXQRRCC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |