C24H22ClN3O2 — CID 40704872
N-(2-chloro-4-methylphenyl)-2-[2-[(1R)-1-phenoxyethyl]benzimidazol-1-yl]acetamide (PubChem CID 40704872) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-[2-[(1R)-1-phenoxyethyl]benzimidazol-1-yl]acetamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-[2-[(1R)-1-phenoxyethyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 40704872 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-[2-[(1R)-1-phenoxyethyl]benzimidazol-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c([C@@H](C)Oc3ccccc3)nc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C24H22ClN3O2/c1-16-12-13-20(19(25)14-16)26-23(29)15-28-22-11-7-6-10-21(22)27-24(28)17(2)30-18-8-4-3-5-9-18/h3-14,17H,15H2,1-2H3,(H,26,29)/t17-/m1/s1 |
| InChIKey | MKFIHBGVSYVGFM-QGZVFWFLSA-N |
| XLogP | 5.78 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |