C25H24ClN3O2 — CID 90069141
N-(2-chloro-4-methylphenyl)-3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]propanamide (PubChem CID 90069141) has the molecular formula C25H24ClN3O2 and a molecular weight of 433.94 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]propanamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]propanamide |
|---|---|
| PubChem CID | 90069141 |
| Molecular Formula | C25H24ClN3O2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]propanamide |
| SMILES | COc1ccc(Cn2c(CCC(=O)Nc3ccc(C)cc3Cl)nc3ccccc32)cc1 |
| InChI | InChI=1S/C25H24ClN3O2/c1-17-7-12-21(20(26)15-17)28-25(30)14-13-24-27-22-5-3-4-6-23(22)29(24)16-18-8-10-19(31-2)11-9-18/h3-12,15H,13-14,16H2,1-2H3,(H,28,30) |
| InChIKey | LNDYPXFWQXSUQI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |