C30H34FN3O — CID 170004275
N-(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)-4-fluoropyridine-3-carboxamide (PubChem CID 170004275) has the molecular formula C30H34FN3O and a molecular weight of 471.62 g/mol. Its IUPAC name is N-(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)-4-fluoropyridine-3-carboxamide.
| Compound Name | N-(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)-4-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 170004275 |
| Molecular Formula | C30H34FN3O |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | N-(10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl)-4-fluoropyridine-3-carboxamide |
| SMILES | CC12CCC(NC(=O)c3cnccc3F)CC1=CCC1C2CCC2(C)C(c3cccnc3)=CCC12 |
| InChI | InChI=1S/C30H34FN3O/c1-29-12-9-21(34-28(35)23-18-33-15-11-27(23)31)16-20(29)5-6-22-25-8-7-24(19-4-3-14-32-17-19)30(25,2)13-10-26(22)29/h3-5,7,11,14-15,17-18,21-22,25-26H,6,8-10,12-13,16H2,1-2H3,(H,34,35) |
| InChIKey | TVVXPAIGGSBECA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|