C30H31ClOS — CID 170006689
2-[4-chloro-2-(5,5-dimethyldibenzothiophen-3-yl)phenyl]adamantan-2-ol (PubChem CID 170006689) has the molecular formula C30H31ClOS and a molecular weight of 475.10 g/mol. Its IUPAC name is 2-[4-chloro-2-(5,5-dimethyldibenzothiophen-3-yl)phenyl]adamantan-2-ol.
| Compound Name | 2-[4-chloro-2-(5,5-dimethyldibenzothiophen-3-yl)phenyl]adamantan-2-ol |
|---|---|
| PubChem CID | 170006689 |
| Molecular Formula | C30H31ClOS |
| Molecular Weight | 475.10 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[4-chloro-2-(5,5-dimethyldibenzothiophen-3-yl)phenyl]adamantan-2-ol |
| SMILES | CS1(C)c2ccccc2-c2ccc(-c3cc(Cl)ccc3C3(O)C4CC5CC(C4)CC3C5)cc21 |
| InChI | InChI=1S/C30H31ClOS/c1-33(2)28-6-4-3-5-24(28)25-9-7-20(16-29(25)33)26-17-23(31)8-10-27(26)30(32)21-12-18-11-19(14-21)15-22(30)13-18/h3-10,16-19,21-22,32H,11-15H2,1-2H3 |
| InChIKey | INDGJOLZBWIJLL-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.10 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |