C17H33IN2O5 — CID 170007577
N-[3-[3-[3-[[2-(1-iodoethoxy)acetyl]amino]propoxy]propoxy]propyl]-2-methylpropanamide (PubChem CID 170007577) has the molecular formula C17H33IN2O5 and a molecular weight of 472.36 g/mol. Its IUPAC name is N-[3-[3-[3-[[2-(1-iodoethoxy)acetyl]amino]propoxy]propoxy]propyl]-2-methylpropanamide.
| Compound Name | N-[3-[3-[3-[[2-(1-iodoethoxy)acetyl]amino]propoxy]propoxy]propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 170007577 |
| Molecular Formula | C17H33IN2O5 |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[3-[3-[3-[[2-(1-iodoethoxy)acetyl]amino]propoxy]propoxy]propyl]-2-methylpropanamide |
| SMILES | CC(I)OCC(=O)NCCCOCCCOCCCNC(=O)C(C)C |
| InChI | InChI=1S/C17H33IN2O5/c1-14(2)17(22)20-8-5-10-24-12-6-11-23-9-4-7-19-16(21)13-25-15(3)18/h14-15H,4-13H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | YYDOYFZHBTYMEF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|