C29H22N6O — CID 170007922
4-[(2-cyanoquinolin-8-yl)amino]-N-[4-[[(E)-4-ethynyliminobut-2-en-2-yl]amino]phenyl]benzamide (PubChem CID 170007922) has the molecular formula C29H22N6O and a molecular weight of 470.54 g/mol. Its IUPAC name is 4-[(2-cyanoquinolin-8-yl)amino]-N-[4-[[(E)-4-ethynyliminobut-2-en-2-yl]amino]phenyl]benzamide.
| Compound Name | 4-[(2-cyanoquinolin-8-yl)amino]-N-[4-[[(E)-4-ethynyliminobut-2-en-2-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 170007922 |
| Molecular Formula | C29H22N6O |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-[(2-cyanoquinolin-8-yl)amino]-N-[4-[[(E)-4-ethynyliminobut-2-en-2-yl]amino]phenyl]benzamide |
| SMILES | C#C/N=C/C=C(\C)Nc1ccc(NC(=O)c2ccc(Nc3cccc4ccc(C#N)nc34)cc2)cc1 |
| InChI | InChI=1S/C29H22N6O/c1-3-31-18-17-20(2)32-23-13-15-25(16-14-23)35-29(36)22-8-10-24(11-9-22)33-27-6-4-5-21-7-12-26(19-30)34-28(21)27/h1,4-18,32-33H,2H3,(H,35,36)/b20-17+,31-18+ |
| InChIKey | CJAJSSYSZIXEMU-WILOGQABSA-N |
| XLogP | 6.08 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|