C28H21N7 — CID 170228639
4-[(2-cyanoquinolin-8-yl)amino]-N'-[3-(pyridin-4-ylamino)phenyl]benzenecarboximidamide (PubChem CID 170228639) has the molecular formula C28H21N7 and a molecular weight of 455.53 g/mol. Its IUPAC name is 4-[(2-cyanoquinolin-8-yl)amino]-N'-[3-(pyridin-4-ylamino)phenyl]benzenecarboximidamide.
| Compound Name | 4-[(2-cyanoquinolin-8-yl)amino]-N'-[3-(pyridin-4-ylamino)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 170228639 |
| Molecular Formula | C28H21N7 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 4-[(2-cyanoquinolin-8-yl)amino]-N'-[3-(pyridin-4-ylamino)phenyl]benzenecarboximidamide |
| SMILES | N#Cc1ccc2cccc(Nc3ccc(/C(N)=N/c4cccc(Nc5ccncc5)c4)cc3)c2n1 |
| InChI | InChI=1S/C28H21N7/c29-18-25-12-7-19-3-1-6-26(27(19)34-25)33-21-10-8-20(9-11-21)28(30)35-24-5-2-4-23(17-24)32-22-13-15-31-16-14-22/h1-17,33H,(H2,30,35)(H,31,32) |
| InChIKey | KXWLLMZSPXGLGX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|