C22H23N3O6S — CID 170012437
4-(2-methylpropanoyl)-N-[2-[4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)phenoxy]ethyl]benzamide (PubChem CID 170012437) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is 4-(2-methylpropanoyl)-N-[2-[4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)phenoxy]ethyl]benzamide.
| Compound Name | 4-(2-methylpropanoyl)-N-[2-[4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 170012437 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 4-(2-methylpropanoyl)-N-[2-[4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)phenoxy]ethyl]benzamide |
| SMILES | CC(C)C(=O)c1ccc(C(=O)NCCOc2ccc(-c3nnc(S(C)(=O)=O)o3)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O6S/c1-14(2)19(26)15-4-6-16(7-5-15)20(27)23-12-13-30-18-10-8-17(9-11-18)21-24-25-22(31-21)32(3,28)29/h4-11,14H,12-13H2,1-3H3,(H,23,27) |
| InChIKey | GLXNSJBCGYOPOV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|