C21H25N7O — CID 170013460
3-amino-2-methyl-6-[6-[3-(methylamino)pyrrolidin-1-yl]pyrido[2,3-d]pyrimidin-2-yl]-4-(methyliminomethyl)phenol (PubChem CID 170013460) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is 3-amino-2-methyl-6-[6-[3-(methylamino)pyrrolidin-1-yl]pyrido[2,3-d]pyrimidin-2-yl]-4-(methyliminomethyl)phenol.
| Compound Name | 3-amino-2-methyl-6-[6-[3-(methylamino)pyrrolidin-1-yl]pyrido[2,3-d]pyrimidin-2-yl]-4-(methyliminomethyl)phenol |
|---|---|
| PubChem CID | 170013460 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 3-amino-2-methyl-6-[6-[3-(methylamino)pyrrolidin-1-yl]pyrido[2,3-d]pyrimidin-2-yl]-4-(methyliminomethyl)phenol |
| SMILES | C/N=C/c1cc(-c2ncc3cc(N4CCC(NC)C4)cnc3n2)c(O)c(C)c1N |
| InChI | InChI=1S/C21H25N7O/c1-12-18(22)13(8-23-2)7-17(19(12)29)21-25-9-14-6-16(10-26-20(14)27-21)28-5-4-15(11-28)24-3/h6-10,15,24,29H,4-5,11,22H2,1-3H3/b23-8+ |
| InChIKey | IFFJVYAWGSCYOI-LIMNOBDPSA-N |
| XLogP | 2.13 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|