C25H32N6O — CID 170013676
1-[7-[4-amino-2-methoxy-5-(methyliminomethyl)phenyl]-1,8-naphthyridin-3-yl]-N-tert-butylpyrrolidin-3-amine (PubChem CID 170013676) has the molecular formula C25H32N6O and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-[7-[4-amino-2-methoxy-5-(methyliminomethyl)phenyl]-1,8-naphthyridin-3-yl]-N-tert-butylpyrrolidin-3-amine.
| Compound Name | 1-[7-[4-amino-2-methoxy-5-(methyliminomethyl)phenyl]-1,8-naphthyridin-3-yl]-N-tert-butylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 170013676 |
| Molecular Formula | C25H32N6O |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 1-[7-[4-amino-2-methoxy-5-(methyliminomethyl)phenyl]-1,8-naphthyridin-3-yl]-N-tert-butylpyrrolidin-3-amine |
| SMILES | C/N=C/c1cc(-c2ccc3cc(N4CCC(NC(C)(C)C)C4)cnc3n2)c(OC)cc1N |
| InChI | InChI=1S/C25H32N6O/c1-25(2,3)30-18-8-9-31(15-18)19-10-16-6-7-22(29-24(16)28-14-19)20-11-17(13-27-4)21(26)12-23(20)32-5/h6-7,10-14,18,30H,8-9,15,26H2,1-5H3/b27-13+ |
| InChIKey | ZMQXJXBDKWBYDE-UVHMKAGCSA-N |
| XLogP | 3.90 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|