C32H57NO5 — CID 170018554
[(Z)-12-oct-2-ynoxycarbonyloxyoctadec-9-enyl] 3-(dimethylamino)propanoate (PubChem CID 170018554) has the molecular formula C32H57NO5 and a molecular weight of 535.81 g/mol. Its IUPAC name is [(Z)-12-oct-2-ynoxycarbonyloxyoctadec-9-enyl] 3-(dimethylamino)propanoate.
| Compound Name | [(Z)-12-oct-2-ynoxycarbonyloxyoctadec-9-enyl] 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 170018554 |
| Molecular Formula | C32H57NO5 |
| Molecular Weight | 535.81 g/mol |
| Exact Mass | 535.42 |
| IUPAC Name | [(Z)-12-oct-2-ynoxycarbonyloxyoctadec-9-enyl] 3-(dimethylamino)propanoate |
| SMILES | CCCCCC#CCOC(=O)OC(C/C=C\CCCCCCCCOC(=O)CCN(C)C)CCCCCC |
| InChI | InChI=1S/C32H57NO5/c1-5-7-9-11-18-23-29-37-32(35)38-30(24-20-10-8-6-2)25-21-17-15-13-12-14-16-19-22-28-36-31(34)26-27-33(3)4/h17,21,30H,5-16,19-20,22,24-29H2,1-4H3/b21-17- |
| InChIKey | DKGQFSVOGVQHGQ-FXBPSFAMSA-N |
| XLogP | 8.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.81 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|