C15H11N5O5 — CID 170026869
[5-[3-(2-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]benzotriazol-1-yl]methanetriol (PubChem CID 170026869) has the molecular formula C15H11N5O5 and a molecular weight of 341.28 g/mol. Its IUPAC name is [5-[3-(2-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]benzotriazol-1-yl]methanetriol.
| Compound Name | [5-[3-(2-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]benzotriazol-1-yl]methanetriol |
|---|---|
| PubChem CID | 170026869 |
| Molecular Formula | C15H11N5O5 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | [5-[3-(2-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]benzotriazol-1-yl]methanetriol |
| SMILES | Oc1ccccc1-c1noc(-c2ccc3c(c2)nnn3C(O)(O)O)n1 |
| InChI | InChI=1S/C15H11N5O5/c21-12-4-2-1-3-9(12)13-16-14(25-18-13)8-5-6-11-10(7-8)17-19-20(11)15(22,23)24/h1-7,21-24H |
| InChIKey | WVMBQVIIACPBOI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|