C24H33ClN4O4S2 — CID 170028747
5-chloro-N-[2-[4-[(cyclohexylcarbamoylamino)oxysulfanyl-methylamino]phenyl]ethyl]-2-methoxybenzamide;sulfane (PubChem CID 170028747) has the molecular formula C24H33ClN4O4S2 and a molecular weight of 541.14 g/mol. Its IUPAC name is 5-chloro-N-[2-[4-[(cyclohexylcarbamoylamino)oxysulfanyl-methylamino]phenyl]ethyl]-2-methoxybenzamide;sulfane.
| Compound Name | 5-chloro-N-[2-[4-[(cyclohexylcarbamoylamino)oxysulfanyl-methylamino]phenyl]ethyl]-2-methoxybenzamide;sulfane |
|---|---|
| PubChem CID | 170028747 |
| Molecular Formula | C24H33ClN4O4S2 |
| Molecular Weight | 541.14 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 5-chloro-N-[2-[4-[(cyclohexylcarbamoylamino)oxysulfanyl-methylamino]phenyl]ethyl]-2-methoxybenzamide;sulfane |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCc1ccc(N(C)SONC(=O)NC2CCCCC2)cc1.S |
| InChI | InChI=1S/C24H31ClN4O4S.H2S/c1-29(34-33-28-24(31)27-19-6-4-3-5-7-19)20-11-8-17(9-12-20)14-15-26-23(30)21-16-18(25)10-13-22(21)32-2;/h8-13,16,19H,3-7,14-15H2,1-2H3,(H,26,30)(H2,27,28,31);1H2 |
| InChIKey | RRCOGXHNMQSQNA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.14 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|