C25H31BClN3O5 — CID 155589547
[[4-[3-[(5-chloro-2-methoxybenzoyl)amino]propyl]phenyl]-(cyclohexylcarbamoylamino)boranyl] formate (PubChem CID 155589547) has the molecular formula C25H31BClN3O5 and a molecular weight of 499.80 g/mol. Its IUPAC name is [[4-[3-[(5-chloro-2-methoxybenzoyl)amino]propyl]phenyl]-(cyclohexylcarbamoylamino)boranyl] formate.
| Compound Name | [[4-[3-[(5-chloro-2-methoxybenzoyl)amino]propyl]phenyl]-(cyclohexylcarbamoylamino)boranyl] formate |
|---|---|
| PubChem CID | 155589547 |
| Molecular Formula | C25H31BClN3O5 |
| Molecular Weight | 499.80 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | [[4-[3-[(5-chloro-2-methoxybenzoyl)amino]propyl]phenyl]-(cyclohexylcarbamoylamino)boranyl] formate |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCCc1ccc(B(NC(=O)NC2CCCCC2)OC=O)cc1 |
| InChI | InChI=1S/C25H31BClN3O5/c1-34-23-14-13-20(27)16-22(23)24(32)28-15-5-6-18-9-11-19(12-10-18)26(35-17-31)30-25(33)29-21-7-3-2-4-8-21/h9-14,16-17,21H,2-8,15H2,1H3,(H,28,32)(H2,29,30,33) |
| InChIKey | VCMRGRVQUCYXCK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.80 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|