C22H25ClN4O4 — CID 170038285
(4S,6S)-N-[(3-chloro-2-methylphenyl)methyl]-10-hydroxy-N,4,7-trimethyl-8,11-dioxo-1,2,7-triazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide (PubChem CID 170038285) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is (4S,6S)-N-[(3-chloro-2-methylphenyl)methyl]-10-hydroxy-N,4,7-trimethyl-8,11-dioxo-1,2,7-triazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide.
| Compound Name | (4S,6S)-N-[(3-chloro-2-methylphenyl)methyl]-10-hydroxy-N,4,7-trimethyl-8,11-dioxo-1,2,7-triazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 170038285 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (4S,6S)-N-[(3-chloro-2-methylphenyl)methyl]-10-hydroxy-N,4,7-trimethyl-8,11-dioxo-1,2,7-triazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide |
| SMILES | Cc1c(Cl)cccc1CN(C)C(=O)c1cn2c(c(O)c1=O)C(=O)N(C)[C@@H]1C[C@H](C)CN12 |
| InChI | InChI=1S/C22H25ClN4O4/c1-12-8-17-25(4)22(31)18-20(29)19(28)15(11-27(18)26(17)9-12)21(30)24(3)10-14-6-5-7-16(23)13(14)2/h5-7,11-12,17,29H,8-10H2,1-4H3/t12-,17-/m0/s1 |
| InChIKey | ZZPHXWHQWKLFFL-SJCJKPOMSA-N |
| XLogP | 2.18 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |