C23H29N4O4P — CID 170038393
(3R,6S)-7-ethyl-10-hydroxy-N,3-dimethyl-N-[(2-methyl-4-phosphanylphenyl)methyl]-8,11-dioxo-1,2,7-triazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide (PubChem CID 170038393) has the molecular formula C23H29N4O4P and a molecular weight of 456.48 g/mol. Its IUPAC name is (3R,6S)-7-ethyl-10-hydroxy-N,3-dimethyl-N-[(2-methyl-4-phosphanylphenyl)methyl]-8,11-dioxo-1,2,7-triazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide.
| Compound Name | (3R,6S)-7-ethyl-10-hydroxy-N,3-dimethyl-N-[(2-methyl-4-phosphanylphenyl)methyl]-8,11-dioxo-1,2,7-triazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 170038393 |
| Molecular Formula | C23H29N4O4P |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (3R,6S)-7-ethyl-10-hydroxy-N,3-dimethyl-N-[(2-methyl-4-phosphanylphenyl)methyl]-8,11-dioxo-1,2,7-triazatricyclo[7.4.0.02,6]trideca-9,12-diene-12-carboxamide |
| SMILES | CCN1C(=O)c2c(O)c(=O)c(C(=O)N(C)Cc3ccc(P)cc3C)cn2N2[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C23H29N4O4P/c1-5-25-18-9-6-14(3)27(18)26-12-17(20(28)21(29)19(26)23(25)31)22(30)24(4)11-15-7-8-16(32)10-13(15)2/h7-8,10,12,14,18,29H,5-6,9,11,32H2,1-4H3/t14-,18+/m1/s1 |
| InChIKey | FZMZFPHMWJQNHK-KDOFPFPSSA-N |
| XLogP | 1.56 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|