C23H28N4O4 — CID 170037836
(7S)-N-[(2,4-dimethylphenyl)methyl]-8-ethyl-11-hydroxy-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide (PubChem CID 170037836) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is (7S)-N-[(2,4-dimethylphenyl)methyl]-8-ethyl-11-hydroxy-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | (7S)-N-[(2,4-dimethylphenyl)methyl]-8-ethyl-11-hydroxy-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 170037836 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (7S)-N-[(2,4-dimethylphenyl)methyl]-8-ethyl-11-hydroxy-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CCN1C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(C)cc3C)cn2N2CCCC[C@@H]12 |
| InChI | InChI=1S/C23H28N4O4/c1-4-25-18-7-5-6-10-26(18)27-13-17(20(28)21(29)19(27)23(25)31)22(30)24-12-16-9-8-14(2)11-15(16)3/h8-9,11,13,18,29H,4-7,10,12H2,1-3H3,(H,24,30)/t18-/m0/s1 |
| InChIKey | FMABBAMJGVZBDX-SFHVURJKSA-N |
| XLogP | 2.02 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |