C23H28FN5O4 — CID 170038537
(5S,7S)-8-ethyl-N-[(2-fluoro-6-methyl-3-pyridinyl)methyl]-11-methoxy-5-methyl-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide (PubChem CID 170038537) has the molecular formula C23H28FN5O4 and a molecular weight of 457.51 g/mol. Its IUPAC name is (5S,7S)-8-ethyl-N-[(2-fluoro-6-methyl-3-pyridinyl)methyl]-11-methoxy-5-methyl-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | (5S,7S)-8-ethyl-N-[(2-fluoro-6-methyl-3-pyridinyl)methyl]-11-methoxy-5-methyl-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 170038537 |
| Molecular Formula | C23H28FN5O4 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (5S,7S)-8-ethyl-N-[(2-fluoro-6-methyl-3-pyridinyl)methyl]-11-methoxy-5-methyl-9,12-dioxo-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CCN1C(=O)c2c(OC)c(=O)c(C(=O)NCc3ccc(C)nc3F)cn2N2CC[C@H](C)C[C@@H]12 |
| InChI | InChI=1S/C23H28FN5O4/c1-5-27-17-10-13(2)8-9-28(17)29-12-16(19(30)20(33-4)18(29)23(27)32)22(31)25-11-15-7-6-14(3)26-21(15)24/h6-7,12-13,17H,5,8-11H2,1-4H3,(H,25,31)/t13-,17-/m0/s1 |
| InChIKey | NDVCQNDWXUYKAH-GUYCJALGSA-N |
| XLogP | 1.80 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|