C11H24O3 — CID 170039008
2-(3-ethoxy-2,3-dimethylbutan-2-yl)oxypropan-2-ol (PubChem CID 170039008) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-(3-ethoxy-2,3-dimethylbutan-2-yl)oxypropan-2-ol.
| Compound Name | 2-(3-ethoxy-2,3-dimethylbutan-2-yl)oxypropan-2-ol |
|---|---|
| PubChem CID | 170039008 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 2-(3-ethoxy-2,3-dimethylbutan-2-yl)oxypropan-2-ol |
| SMILES | CCOC(C)(C)C(C)(C)OC(C)(C)O |
| InChI | InChI=1S/C11H24O3/c1-8-13-9(2,3)10(4,5)14-11(6,7)12/h12H,8H2,1-7H3 |
| InChIKey | NQXDWZBSHQPSEE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|