C10H22O4Ti — CID 87321187
titanium;1,1,2-triethoxy-2-methylpropan-1-ol (PubChem CID 87321187) has the molecular formula C10H22O4Ti and a molecular weight of 254.15 g/mol. Its IUPAC name is titanium;1,1,2-triethoxy-2-methylpropan-1-ol.
| Compound Name | titanium;1,1,2-triethoxy-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 87321187 |
| Molecular Formula | C10H22O4Ti |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | titanium;1,1,2-triethoxy-2-methylpropan-1-ol |
| SMILES | CCOC(C)(C)C(O)(OCC)OCC.[Ti] |
| InChI | InChI=1S/C10H22O4.Ti/c1-6-12-9(4,5)10(11,13-7-2)14-8-3;/h11H,6-8H2,1-5H3; |
| InChIKey | YLJGFYDSFPXQLI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|