About methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate
methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate (PubChem CID 170040063) has the molecular formula C11H21N3OS
and a molecular weight of 243.38 g/mol. Its IUPAC name is methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate |
| PubChem CID | 170040063 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate |
| SMILES | C=C(N/C(=N/C(C)C)SC)N1CCOCC1 |
| InChI | InChI=1S/C11H21N3OS/c1-9(2)12-11(16-4)13-10(3)14-5-7-15-8-6-14/h9H,3,5-8H2,1-2,4H3,(H,12,13) |
| InChIKey | XGWAJRKHXFFRPZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate?
The IUPAC name of methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate (CID 170040063) is methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate.
What is the SMILES notation for methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate?
The canonical SMILES for methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate is C=C(N/C(=N/C(C)C)SC)N1CCOCC1.
What is the InChIKey of methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate?
The InChIKey is XGWAJRKHXFFRPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3OS/c1-9(2)12-11(16-4)13-10(3)14-5-7-15-8-6-14/h9H,3,5-8H2,1-2,4H3,(H,12,13).
What are the key properties of methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate?
methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate has a molecular weight of 243.38 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(1-morpholin-4-ylethenyl)-N'-propan-2-ylcarbamimidothioate is sourced from PubChem (CID 170040063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).