C10H15N3O — CID 170040672
4-N-methyl-3-N-(3-methyloxetan-3-yl)pyridine-3,4-diamine (PubChem CID 170040672) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-N-methyl-3-N-(3-methyloxetan-3-yl)pyridine-3,4-diamine.
| Compound Name | 4-N-methyl-3-N-(3-methyloxetan-3-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 170040672 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 4-N-methyl-3-N-(3-methyloxetan-3-yl)pyridine-3,4-diamine |
| SMILES | CNc1ccncc1NC1(C)COC1 |
| InChI | InChI=1S/C10H15N3O/c1-10(6-14-7-10)13-9-5-12-4-3-8(9)11-2/h3-5,13H,6-7H2,1-2H3,(H,11,12) |
| InChIKey | SVQWFMHUNAVXDO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |