C9H13N3O — CID 162530862
3-N-(3-methyloxetan-3-yl)pyridine-3,4-diamine (PubChem CID 162530862) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-N-(3-methyloxetan-3-yl)pyridine-3,4-diamine.
| Compound Name | 3-N-(3-methyloxetan-3-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 162530862 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-N-(3-methyloxetan-3-yl)pyridine-3,4-diamine |
| SMILES | CC1(Nc2cnccc2N)COC1 |
| InChI | InChI=1S/C9H13N3O/c1-9(5-13-6-9)12-8-4-11-3-2-7(8)10/h2-4,12H,5-6H2,1H3,(H2,10,11) |
| InChIKey | XDKFPOAFSIEYCN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |