C10H12N4O4S — CID 66061070
4-[[4-(methylamino)-3-pyridinyl]sulfonyl]piperazine-2,6-dione (PubChem CID 66061070) has the molecular formula C10H12N4O4S and a molecular weight of 284.30 g/mol. Its IUPAC name is 4-[[4-(methylamino)-3-pyridinyl]sulfonyl]piperazine-2,6-dione.
| Compound Name | 4-[[4-(methylamino)-3-pyridinyl]sulfonyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66061070 |
| Molecular Formula | C10H12N4O4S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-[[4-(methylamino)-3-pyridinyl]sulfonyl]piperazine-2,6-dione |
| SMILES | CNc1ccncc1S(=O)(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C10H12N4O4S/c1-11-7-2-3-12-4-8(7)19(17,18)14-5-9(15)13-10(16)6-14/h2-4H,5-6H2,1H3,(H,11,12)(H,13,15,16) |
| InChIKey | RRUQTXMKULWZAT-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|