C9H8ClN3O4S — CID 66083611
4-[(4-chloro-3-pyridinyl)sulfonyl]piperazine-2,6-dione (PubChem CID 66083611) has the molecular formula C9H8ClN3O4S and a molecular weight of 289.70 g/mol. Its IUPAC name is 4-[(4-chloro-3-pyridinyl)sulfonyl]piperazine-2,6-dione.
| Compound Name | 4-[(4-chloro-3-pyridinyl)sulfonyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66083611 |
| Molecular Formula | C9H8ClN3O4S |
| Molecular Weight | 289.70 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 4-[(4-chloro-3-pyridinyl)sulfonyl]piperazine-2,6-dione |
| SMILES | O=C1CN(S(=O)(=O)c2cnccc2Cl)CC(=O)N1 |
| InChI | InChI=1S/C9H8ClN3O4S/c10-6-1-2-11-3-7(6)18(16,17)13-4-8(14)12-9(15)5-13/h1-3H,4-5H2,(H,12,14,15) |
| InChIKey | TXLWEQBTXVFHQW-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.70 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|