C8H11F3NO+ — CID 170047355
hydroxy-methylidene-[(2Z)-1,1,1-trifluoro-5-methylhexa-2,4-dien-2-yl]azanium (PubChem CID 170047355) has the molecular formula C8H11F3NO+ and a molecular weight of 194.18 g/mol. Its IUPAC name is hydroxy-methylidene-[(2Z)-1,1,1-trifluoro-5-methylhexa-2,4-dien-2-yl]azanium.
| Compound Name | hydroxy-methylidene-[(2Z)-1,1,1-trifluoro-5-methylhexa-2,4-dien-2-yl]azanium |
|---|---|
| PubChem CID | 170047355 |
| Molecular Formula | C8H11F3NO+ |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | hydroxy-methylidene-[(2Z)-1,1,1-trifluoro-5-methylhexa-2,4-dien-2-yl]azanium |
| SMILES | C=[N+](O)/C(=C\C=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H11F3NO/c1-6(2)4-5-7(12(3)13)8(9,10)11/h4-5,13H,3H2,1-2H3/q+1/b7-5- |
| InChIKey | CQGIHIMUOOYPLJ-ALCCZGGFSA-N |
| XLogP | 2.50 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|