C13H23NO7 — CID 170051192
4-hydroxy-6-[(1R,2E)-1-hydroxy-2-propoxyiminoethyl]-2-methoxy-5-methyloxane-2-carboxylic acid (PubChem CID 170051192) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-hydroxy-6-[(1R,2E)-1-hydroxy-2-propoxyiminoethyl]-2-methoxy-5-methyloxane-2-carboxylic acid.
| Compound Name | 4-hydroxy-6-[(1R,2E)-1-hydroxy-2-propoxyiminoethyl]-2-methoxy-5-methyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 170051192 |
| Molecular Formula | C13H23NO7 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-hydroxy-6-[(1R,2E)-1-hydroxy-2-propoxyiminoethyl]-2-methoxy-5-methyloxane-2-carboxylic acid |
| SMILES | CCCO/N=C/[C@@H](O)C1OC(OC)(C(=O)O)CC(O)C1C |
| InChI | InChI=1S/C13H23NO7/c1-4-5-20-14-7-10(16)11-8(2)9(15)6-13(19-3,21-11)12(17)18/h7-11,15-16H,4-6H2,1-3H3,(H,17,18)/b14-7+/t8?,9?,10-,11?,13?/m1/s1 |
| InChIKey | ZPAKYICSTJKMMG-ZTSCYJFOSA-N |
| XLogP | -0.03 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|