C13H24O6 — CID 91135529
4-hydroxy-6-(2-hydroxypentan-3-yl)-2-methoxy-5-methyloxane-2-carboxylic acid (PubChem CID 91135529) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-hydroxy-6-(2-hydroxypentan-3-yl)-2-methoxy-5-methyloxane-2-carboxylic acid.
| Compound Name | 4-hydroxy-6-(2-hydroxypentan-3-yl)-2-methoxy-5-methyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91135529 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-hydroxy-6-(2-hydroxypentan-3-yl)-2-methoxy-5-methyloxane-2-carboxylic acid |
| SMILES | CCC(C(C)O)C1OC(OC)(C(=O)O)CC(O)C1C |
| InChI | InChI=1S/C13H24O6/c1-5-9(8(3)14)11-7(2)10(15)6-13(18-4,19-11)12(16)17/h7-11,14-15H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | GKZLMUDPMLRFKJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |