C19H32N2O2 — CID 170053117
N-[(E)-4-[(1-hydroxy-2-methylprop-2-enyl)-prop-2-enylamino]but-2-enyl]-2-methyl-N-(2-methylpropyl)prop-2-enamide (PubChem CID 170053117) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-[(E)-4-[(1-hydroxy-2-methylprop-2-enyl)-prop-2-enylamino]but-2-enyl]-2-methyl-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | N-[(E)-4-[(1-hydroxy-2-methylprop-2-enyl)-prop-2-enylamino]but-2-enyl]-2-methyl-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 170053117 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | N-[(E)-4-[(1-hydroxy-2-methylprop-2-enyl)-prop-2-enylamino]but-2-enyl]-2-methyl-N-(2-methylpropyl)prop-2-enamide |
| SMILES | C=CCN(C/C=C/CN(CC(C)C)C(=O)C(=C)C)C(O)C(=C)C |
| InChI | InChI=1S/C19H32N2O2/c1-8-11-20(18(22)16(4)5)12-9-10-13-21(14-15(2)3)19(23)17(6)7/h8-10,15,18,22H,1,4,6,11-14H2,2-3,5,7H3/b10-9+ |
| InChIKey | BGSAOBXVHPNJON-MDZDMXLPSA-N |
| XLogP | 2.99 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|