C21H18F2N2O2 — CID 170054463
4-[2-[(3,5-difluorophenoxy)methyl]-4-pyridinyl]-N,2-dimethylbenzamide (PubChem CID 170054463) has the molecular formula C21H18F2N2O2 and a molecular weight of 368.38 g/mol. Its IUPAC name is 4-[2-[(3,5-difluorophenoxy)methyl]-4-pyridinyl]-N,2-dimethylbenzamide.
| Compound Name | 4-[2-[(3,5-difluorophenoxy)methyl]-4-pyridinyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 170054463 |
| Molecular Formula | C21H18F2N2O2 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-[2-[(3,5-difluorophenoxy)methyl]-4-pyridinyl]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(-c2ccnc(COc3cc(F)cc(F)c3)c2)cc1C |
| InChI | InChI=1S/C21H18F2N2O2/c1-13-7-14(3-4-20(13)21(26)24-2)15-5-6-25-18(8-15)12-27-19-10-16(22)9-17(23)11-19/h3-11H,12H2,1-2H3,(H,24,26) |
| InChIKey | VTVFSRPGWOJUJT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |