C11H18N2O — CID 170054921
(2R,3S)-N-cyclopentyl-3-cyclopropylaziridine-2-carboxamide (PubChem CID 170054921) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (2R,3S)-N-cyclopentyl-3-cyclopropylaziridine-2-carboxamide.
| Compound Name | (2R,3S)-N-cyclopentyl-3-cyclopropylaziridine-2-carboxamide |
|---|---|
| PubChem CID | 170054921 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (2R,3S)-N-cyclopentyl-3-cyclopropylaziridine-2-carboxamide |
| SMILES | O=C(NC1CCCC1)[C@@H]1N[C@H]1C1CC1 |
| InChI | InChI=1S/C11H18N2O/c14-11(12-8-3-1-2-4-8)10-9(13-10)7-5-6-7/h7-10,13H,1-6H2,(H,12,14)/t9-,10+/m0/s1 |
| InChIKey | SNMOXQICCSMKIZ-VHSXEESVSA-N |
| XLogP | 0.80 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|