C7H12N2O — CID 170982801
3-cyclopropyl-N-methylaziridine-2-carboxamide (PubChem CID 170982801) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 3-cyclopropyl-N-methylaziridine-2-carboxamide.
| Compound Name | 3-cyclopropyl-N-methylaziridine-2-carboxamide |
|---|---|
| PubChem CID | 170982801 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3-cyclopropyl-N-methylaziridine-2-carboxamide |
| SMILES | CNC(=O)C1NC1C1CC1 |
| InChI | InChI=1S/C7H12N2O/c1-8-7(10)6-5(9-6)4-2-3-4/h4-6,9H,2-3H2,1H3,(H,8,10) |
| InChIKey | GDDXBNSQEALNQJ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|