C13H21N3O2 — CID 170982794
1-[(2R,3R)-3-cyclopropylaziridine-2-carbonyl]-N,4-dimethylpyrrolidine-3-carboxamide (PubChem CID 170982794) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[(2R,3R)-3-cyclopropylaziridine-2-carbonyl]-N,4-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-[(2R,3R)-3-cyclopropylaziridine-2-carbonyl]-N,4-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 170982794 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-[(2R,3R)-3-cyclopropylaziridine-2-carbonyl]-N,4-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1CN(C(=O)[C@@H]2N[C@@H]2C2CC2)CC1C |
| InChI | InChI=1S/C13H21N3O2/c1-7-5-16(6-9(7)12(17)14-2)13(18)11-10(15-11)8-3-4-8/h7-11,15H,3-6H2,1-2H3,(H,14,17)/t7?,9?,10-,11-/m1/s1 |
| InChIKey | GIKDHXKGSVZNEX-LTCAWXSRSA-N |
| XLogP | -0.42 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|