C13H22N4O2 — CID 170055207
[(2R,3R)-3-cyclopropylaziridin-2-yl]-[8-(methylamino)-3-oxa-6,8-diazabicyclo[3.2.2]nonan-6-yl]methanone (PubChem CID 170055207) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(2R,3R)-3-cyclopropylaziridin-2-yl]-[8-(methylamino)-3-oxa-6,8-diazabicyclo[3.2.2]nonan-6-yl]methanone.
| Compound Name | [(2R,3R)-3-cyclopropylaziridin-2-yl]-[8-(methylamino)-3-oxa-6,8-diazabicyclo[3.2.2]nonan-6-yl]methanone |
|---|---|
| PubChem CID | 170055207 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | [(2R,3R)-3-cyclopropylaziridin-2-yl]-[8-(methylamino)-3-oxa-6,8-diazabicyclo[3.2.2]nonan-6-yl]methanone |
| SMILES | CNN1CC2COCC1CN2C(=O)[C@@H]1N[C@@H]1C1CC1 |
| InChI | InChI=1S/C13H22N4O2/c1-14-17-5-9-6-19-7-10(17)4-16(9)13(18)12-11(15-12)8-2-3-8/h8-12,14-15H,2-7H2,1H3/t9?,10?,11-,12-/m1/s1 |
| InChIKey | HUYXSPMKYHIWPI-KIDURHIOSA-N |
| XLogP | -1.22 |
| TPSA | 66.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|