C13H21N3O — CID 170055113
[(2R,3S)-3-cyclopropylaziridin-2-yl]-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 170055113) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is [(2R,3S)-3-cyclopropylaziridin-2-yl]-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | [(2R,3S)-3-cyclopropylaziridin-2-yl]-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 170055113 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [(2R,3S)-3-cyclopropylaziridin-2-yl]-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | CN1C2CCC1CN(C(=O)[C@@H]1N[C@H]1C1CC1)C2 |
| InChI | InChI=1S/C13H21N3O/c1-15-9-4-5-10(15)7-16(6-9)13(17)12-11(14-12)8-2-3-8/h8-12,14H,2-7H2,1H3/t9?,10?,11-,12+/m0/s1 |
| InChIKey | VQVDMSHXTPDWCL-MMVSWEMESA-N |
| XLogP | 0.04 |
| TPSA | 45.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|