C15H24N2O2 — CID 170054914
[(2R,3S)-3-cyclopropylaziridin-2-yl]-[(1S,4S)-5-propan-2-yloxy-2-azabicyclo[2.2.1]heptan-2-yl]methanone (PubChem CID 170054914) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is [(2R,3S)-3-cyclopropylaziridin-2-yl]-[(1S,4S)-5-propan-2-yloxy-2-azabicyclo[2.2.1]heptan-2-yl]methanone.
| Compound Name | [(2R,3S)-3-cyclopropylaziridin-2-yl]-[(1S,4S)-5-propan-2-yloxy-2-azabicyclo[2.2.1]heptan-2-yl]methanone |
|---|---|
| PubChem CID | 170054914 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | [(2R,3S)-3-cyclopropylaziridin-2-yl]-[(1S,4S)-5-propan-2-yloxy-2-azabicyclo[2.2.1]heptan-2-yl]methanone |
| SMILES | CC(C)OC1C[C@@H]2C[C@H]1CN2C(=O)[C@@H]1N[C@H]1C1CC1 |
| InChI | InChI=1S/C15H24N2O2/c1-8(2)19-12-6-11-5-10(12)7-17(11)15(18)14-13(16-14)9-3-4-9/h8-14,16H,3-7H2,1-2H3/t10-,11-,12?,13-,14+/m0/s1 |
| InChIKey | LQTWRTAELCMZSC-WSOGJNRSSA-N |
| XLogP | 1.15 |
| TPSA | 51.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|