C12H17N — CID 170054963
(E)-2-(4-propylcyclohepta-1,3,6-trien-1-yl)ethenamine (PubChem CID 170054963) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (E)-2-(4-propylcyclohepta-1,3,6-trien-1-yl)ethenamine.
| Compound Name | (E)-2-(4-propylcyclohepta-1,3,6-trien-1-yl)ethenamine |
|---|---|
| PubChem CID | 170054963 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (E)-2-(4-propylcyclohepta-1,3,6-trien-1-yl)ethenamine |
| SMILES | CCCC1=CC=C(/C=C/N)C=CC1 |
| InChI | InChI=1S/C12H17N/c1-2-4-11-5-3-6-12(8-7-11)9-10-13/h3,6-10H,2,4-5,13H2,1H3/b10-9+ |
| InChIKey | AMRUVMIIGJYYSR-MDZDMXLPSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |