C10H11Cl — CID 145346186
1-(chloromethyl)-4-ethenylcyclohepta-1,3,5-triene (PubChem CID 145346186) has the molecular formula C10H11Cl and a molecular weight of 166.65 g/mol. Its IUPAC name is 1-(chloromethyl)-4-ethenylcyclohepta-1,3,5-triene.
| Compound Name | 1-(chloromethyl)-4-ethenylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 145346186 |
| Molecular Formula | C10H11Cl |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 1-(chloromethyl)-4-ethenylcyclohepta-1,3,5-triene |
| SMILES | C=CC1=CC=C(CCl)CC=C1 |
| InChI | InChI=1S/C10H11Cl/c1-2-9-4-3-5-10(8-11)7-6-9/h2-4,6-7H,1,5,8H2 |
| InChIKey | HJMHLNYEIZLSNA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|