C22H30N2 — CID 138716208
(4Z,6E)-6-[4-[[ethenyl(methyl)amino]methyl]cyclohepta-1,3,6-trien-1-yl]-N,N-dimethyl-3-methylideneocta-1,4,6-trien-2-amine (PubChem CID 138716208) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is (4Z,6E)-6-[4-[[ethenyl(methyl)amino]methyl]cyclohepta-1,3,6-trien-1-yl]-N,N-dimethyl-3-methylideneocta-1,4,6-trien-2-amine.
| Compound Name | (4Z,6E)-6-[4-[[ethenyl(methyl)amino]methyl]cyclohepta-1,3,6-trien-1-yl]-N,N-dimethyl-3-methylideneocta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 138716208 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | (4Z,6E)-6-[4-[[ethenyl(methyl)amino]methyl]cyclohepta-1,3,6-trien-1-yl]-N,N-dimethyl-3-methylideneocta-1,4,6-trien-2-amine |
| SMILES | C=CN(C)CC1=CC=C(C(/C=C\C(=C)C(=C)N(C)C)=C/C)C=CC1 |
| InChI | InChI=1S/C22H30N2/c1-8-21(15-13-18(3)19(4)23(5)6)22-12-10-11-20(14-16-22)17-24(7)9-2/h8-10,12-16H,2-4,11,17H2,1,5-7H3/b15-13-,21-8+ |
| InChIKey | BGAURRBDQQNMAY-KOMIDJNSSA-N |
| XLogP | 5.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|