C19H18 — CID 145350974
4-(3-methylidenepenta-1,4-dien-2-yl)-1-phenylcyclohepta-1,3,5-triene (PubChem CID 145350974) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-(3-methylidenepenta-1,4-dien-2-yl)-1-phenylcyclohepta-1,3,5-triene.
| Compound Name | 4-(3-methylidenepenta-1,4-dien-2-yl)-1-phenylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 145350974 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-(3-methylidenepenta-1,4-dien-2-yl)-1-phenylcyclohepta-1,3,5-triene |
| SMILES | C=CC(=C)C(=C)C1=CC=C(c2ccccc2)CC=C1 |
| InChI | InChI=1S/C19H18/c1-4-15(2)16(3)17-11-8-12-19(14-13-17)18-9-6-5-7-10-18/h4-11,13-14H,1-3,12H2 |
| InChIKey | XJDMCCASRUXIJX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|