About 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine
1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine (PubChem CID 142160073) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine.
Analyze 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine?
The IUPAC name of 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine (CID 142160073) is 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine.
What is the SMILES notation for 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine?
The canonical SMILES for 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine is CN(C)CC1=CC=CC=CC1.
What is the InChIKey of 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine?
The InChIKey is CFNZXZYZIVKRCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-11(2)9-10-7-5-3-4-6-8-10/h3-7H,8-9H2,1-2H3.
What are the key properties of 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine?
1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine has a molecular weight of 149.24 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohepta-1,3,5-trien-1-yl-N,N-dimethylmethanamine is sourced from PubChem (CID 142160073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).