C30H32ClN3O2 — CID 17005802
4-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]-1-(2-phenylethyl)pyrrolidin-2-one (PubChem CID 17005802) has the molecular formula C30H32ClN3O2 and a molecular weight of 502.06 g/mol. Its IUPAC name is 4-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]-1-(2-phenylethyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]-1-(2-phenylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17005802 |
| Molecular Formula | C30H32ClN3O2 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 4-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]-1-(2-phenylethyl)pyrrolidin-2-one |
| SMILES | Cc1cc(OCCCCn2c(C3CC(=O)N(CCc4ccccc4)C3)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C30H32ClN3O2/c1-22-19-25(13-14-26(22)31)36-18-8-7-16-34-28-12-6-5-11-27(28)32-30(34)24-20-29(35)33(21-24)17-15-23-9-3-2-4-10-23/h2-6,9-14,19,24H,7-8,15-18,20-21H2,1H3 |
| InChIKey | FDHIWCHZNIAYNV-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|