About [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane
[1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane (PubChem CID 170059366) has the molecular formula C8H21ClN2P2
and a molecular weight of 242.67 g/mol. Its IUPAC name is [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane.
Molecular Properties
| Compound Name | [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane |
| PubChem CID | 170059366 |
| Molecular Formula | C8H21ClN2P2 |
| Molecular Weight | 242.67 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane |
| SMILES | CC(Cl)(N=P(C)(C)C)N=P(C)(C)C |
| InChI | InChI=1S/C8H21ClN2P2/c1-8(9,10-12(2,3)4)11-13(5,6)7/h1-7H3 |
| InChIKey | YMSRYMAOFQEAEV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane?
The IUPAC name of [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane (CID 170059366) is [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane.
What is the SMILES notation for [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane?
The canonical SMILES for [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane is CC(Cl)(N=P(C)(C)C)N=P(C)(C)C.
What is the InChIKey of [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane?
The InChIKey is YMSRYMAOFQEAEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21ClN2P2/c1-8(9,10-12(2,3)4)11-13(5,6)7/h1-7H3.
What are the key properties of [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane?
[1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane has a molecular weight of 242.67 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-chloro-1-[(trimethyl-λ5-phosphanylidene)amino]ethyl]imino-trimethyl-λ5-phosphane is sourced from PubChem (CID 170059366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).