About benzyl diiodosulfamoylcarbamoyl carbonate
benzyl diiodosulfamoylcarbamoyl carbonate (PubChem CID 170061871) has the molecular formula C9H8I2N2O6S
and a molecular weight of 526.05 g/mol. Its IUPAC name is benzyl diiodosulfamoylcarbamoyl carbonate.
Molecular Properties
| Compound Name | benzyl diiodosulfamoylcarbamoyl carbonate |
| PubChem CID | 170061871 |
| Molecular Formula | C9H8I2N2O6S |
| Molecular Weight | 526.05 g/mol |
| Exact Mass | 525.82 |
| IUPAC Name | benzyl diiodosulfamoylcarbamoyl carbonate |
| SMILES | O=C(NS(=O)(=O)N(I)I)OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C9H8I2N2O6S/c10-13(11)20(16,17)12-8(14)19-9(15)18-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,12,14) |
| InChIKey | CSKHONRJGQWXMU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.05 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze benzyl diiodosulfamoylcarbamoyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl diiodosulfamoylcarbamoyl carbonate?
The IUPAC name of benzyl diiodosulfamoylcarbamoyl carbonate (CID 170061871) is benzyl diiodosulfamoylcarbamoyl carbonate.
What is the SMILES notation for benzyl diiodosulfamoylcarbamoyl carbonate?
The canonical SMILES for benzyl diiodosulfamoylcarbamoyl carbonate is O=C(NS(=O)(=O)N(I)I)OC(=O)OCc1ccccc1.
What is the InChIKey of benzyl diiodosulfamoylcarbamoyl carbonate?
The InChIKey is CSKHONRJGQWXMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8I2N2O6S/c10-13(11)20(16,17)12-8(14)19-9(15)18-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,12,14).
What are the key properties of benzyl diiodosulfamoylcarbamoyl carbonate?
benzyl diiodosulfamoylcarbamoyl carbonate has a molecular weight of 526.05 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl diiodosulfamoylcarbamoyl carbonate is sourced from PubChem (CID 170061871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).