C23H40N3O4P — CID 170062116
2-[8-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]octylamino]ethylphosphonic acid (PubChem CID 170062116) has the molecular formula C23H40N3O4P and a molecular weight of 453.56 g/mol. Its IUPAC name is 2-[8-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]octylamino]ethylphosphonic acid.
| Compound Name | 2-[8-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]octylamino]ethylphosphonic acid |
|---|---|
| PubChem CID | 170062116 |
| Molecular Formula | C23H40N3O4P |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 2-[8-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]octylamino]ethylphosphonic acid |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)NCCCCCCCCNCCP(=O)(O)O)c1 |
| InChI | InChI=1S/C23H40N3O4P/c1-19(2)20-12-11-13-21(18-20)23(3,4)26-22(27)25-15-10-8-6-5-7-9-14-24-16-17-31(28,29)30/h11-13,18,24H,1,5-10,14-17H2,2-4H3,(H2,25,26,27)(H2,28,29,30) |
| InChIKey | OUTPTTMIUXLUSY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|