C19H32N3O4P — CID 169012887
2-[4-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]butylamino]ethylphosphonic acid (PubChem CID 169012887) has the molecular formula C19H32N3O4P and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[4-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]butylamino]ethylphosphonic acid.
| Compound Name | 2-[4-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]butylamino]ethylphosphonic acid |
|---|---|
| PubChem CID | 169012887 |
| Molecular Formula | C19H32N3O4P |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-[4-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]butylamino]ethylphosphonic acid |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)NCCCCNCCP(=O)(O)O)c1 |
| InChI | InChI=1S/C19H32N3O4P/c1-15(2)16-8-7-9-17(14-16)19(3,4)22-18(23)21-11-6-5-10-20-12-13-27(24,25)26/h7-9,14,20H,1,5-6,10-13H2,2-4H3,(H2,21,22,23)(H2,24,25,26) |
| InChIKey | OSXWHNJDPSFHIZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|